Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
Ammonium polyphosphate

Inventory

EC number:
269-789-9
EC name:
Polyphosphoric acids, ammonium salts
CAS number:
68333-79-9
CAS number:
68333-79-9

Synonyms

Molecular and structural information

Molecular formula:
H48N11O25P7
SMILES notation:
OP(O)(=O)OP(O)(=O)OP(O)(O)=O
Structural formula:
Chemical structure

Related substances